C20H38O2 — CID 166592135
2,4,4,5,7,8-hexamethyl-2-pentyl-4a,5,6,7,8,8a-hexahydro-3H-chromen-6-ol (PubChem CID 166592135) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 2,4,4,5,7,8-hexamethyl-2-pentyl-4a,5,6,7,8,8a-hexahydro-3H-chromen-6-ol.
| Compound Name | 2,4,4,5,7,8-hexamethyl-2-pentyl-4a,5,6,7,8,8a-hexahydro-3H-chromen-6-ol |
|---|---|
| PubChem CID | 166592135 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 2,4,4,5,7,8-hexamethyl-2-pentyl-4a,5,6,7,8,8a-hexahydro-3H-chromen-6-ol |
| SMILES | CCCCCC1(C)CC(C)(C)C2C(C)C(O)C(C)C(C)C2O1 |
| InChI | InChI=1S/C20H38O2/c1-8-9-10-11-20(7)12-19(5,6)16-15(4)17(21)13(2)14(3)18(16)22-20/h13-18,21H,8-12H2,1-7H3 |
| InChIKey | FJZBFZGMKAPSNB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|