C32H50N2 — CID 166592297
1,3-bis(3,5-ditert-butylphenyl)-1,3-diazinane (PubChem CID 166592297) has the molecular formula C32H50N2 and a molecular weight of 462.77 g/mol. Its IUPAC name is 1,3-bis(3,5-ditert-butylphenyl)-1,3-diazinane.
| Compound Name | 1,3-bis(3,5-ditert-butylphenyl)-1,3-diazinane |
|---|---|
| PubChem CID | 166592297 |
| Molecular Formula | C32H50N2 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.40 |
| IUPAC Name | 1,3-bis(3,5-ditert-butylphenyl)-1,3-diazinane |
| SMILES | CC(C)(C)c1cc(N2CCCN(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)C2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H50N2/c1-29(2,3)23-16-24(30(4,5)6)19-27(18-23)33-14-13-15-34(22-33)28-20-25(31(7,8)9)17-26(21-28)32(10,11)12/h16-21H,13-15,22H2,1-12H3 |
| InChIKey | PSQCBULVVTXLLU-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |