C13H26N4O6 — CID 166592299
1,3,5,7-tetrakis(methoxymethyl)-4-methyl-1,3,5,7-tetrazocane-2,6-dione (PubChem CID 166592299) has the molecular formula C13H26N4O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(methoxymethyl)-4-methyl-1,3,5,7-tetrazocane-2,6-dione.
| Compound Name | 1,3,5,7-tetrakis(methoxymethyl)-4-methyl-1,3,5,7-tetrazocane-2,6-dione |
|---|---|
| PubChem CID | 166592299 |
| Molecular Formula | C13H26N4O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1,3,5,7-tetrakis(methoxymethyl)-4-methyl-1,3,5,7-tetrazocane-2,6-dione |
| SMILES | COCN1CN(COC)C(=O)N(COC)C(C)N(COC)C1=O |
| InChI | InChI=1S/C13H26N4O6/c1-11-16(9-22-4)12(18)14(7-20-2)6-15(8-21-3)13(19)17(11)10-23-5/h11H,6-10H2,1-5H3 |
| InChIKey | YMVCXEWZCZCFEY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |