C24H24F3N3O2S — CID 166592355
N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N'-[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]ethane-1,2-diamine (PubChem CID 166592355) has the molecular formula C24H24F3N3O2S and a molecular weight of 475.54 g/mol. Its IUPAC name is N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N'-[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]ethane-1,2-diamine.
| Compound Name | N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N'-[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 166592355 |
| Molecular Formula | C24H24F3N3O2S |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-N'-[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]ethane-1,2-diamine |
| SMILES | [H]N=S(=O)(NCCNC1c2ccccc2CCc2ccccc21)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3N3O2S/c25-24(26,27)32-19-11-13-20(14-12-19)33(28,31)30-16-15-29-23-21-7-3-1-5-17(21)9-10-18-6-2-4-8-22(18)23/h1-8,11-14,23,29H,9-10,15-16H2,(H2,28,30,31) |
| InChIKey | GDHTXGFMNLXDBS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|