C32H30F3N5O5S — CID 166592834
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1-(4-nitrophenyl)-5-[[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]amino]piperidin-4-ol (PubChem CID 166592834) has the molecular formula C32H30F3N5O5S and a molecular weight of 653.68 g/mol. Its IUPAC name is 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1-(4-nitrophenyl)-5-[[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]amino]piperidin-4-ol.
| Compound Name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1-(4-nitrophenyl)-5-[[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]amino]piperidin-4-ol |
|---|---|
| PubChem CID | 166592834 |
| Molecular Formula | C32H30F3N5O5S |
| Molecular Weight | 653.68 g/mol |
| Exact Mass | 653.19 |
| IUPAC Name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-1-(4-nitrophenyl)-5-[[[4-(trifluoromethoxy)phenyl]sulfonimidoyl]amino]piperidin-4-ol |
| SMILES | [H]N=S(=O)(NC1CN(c2ccc([N+](=O)[O-])cc2)CC(N2c3ccccc3CCc3ccccc32)C1O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C32H30F3N5O5S/c33-32(34,35)45-25-15-17-26(18-16-25)46(36,44)37-27-19-38(23-11-13-24(14-12-23)40(42)43)20-30(31(27)41)39-28-7-3-1-5-21(28)9-10-22-6-2-4-8-29(22)39/h1-8,11-18,27,30-31,41H,9-10,19-20H2,(H2,36,37,44) |
| InChIKey | KZJAKISQOFVHDN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|