C8H13F4N2O3S+ — CID 166593522
3-ethyl-1-methyl-1H-imidazole-1,3-diium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 166593522) has the molecular formula C8H13F4N2O3S+ and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1H-imidazole-1,3-diium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 3-ethyl-1-methyl-1H-imidazole-1,3-diium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 166593522 |
| Molecular Formula | C8H13F4N2O3S+ |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-ethyl-1-methyl-1H-imidazole-1,3-diium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CC[N+]1=C[NH+](C)C=C1.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C6H11N2.C2H2F4O3S/c1-3-8-5-4-7(2)6-8;3-1(4)2(5,6)10(7,8)9/h4-6H,3H2,1-2H3;1H,(H,7,8,9)/q+1; |
| InChIKey | CTEAXVWYCINNCA-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 64.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|