About [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone
[2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone (PubChem CID 166593599) has the molecular formula C32H21Br2NO
and a molecular weight of 595.33 g/mol. Its IUPAC name is [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone |
| PubChem CID | 166593599 |
| Molecular Formula | C32H21Br2NO |
| Molecular Weight | 595.33 g/mol |
| Exact Mass | 593.00 |
| IUPAC Name | [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(/C=C/c2ccc(Br)cc2)nc2ccccc2c1/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H21Br2NO/c33-25-16-10-22(11-17-25)14-20-28-27-8-4-5-9-29(27)35-30(21-15-23-12-18-26(34)19-13-23)31(28)32(36)24-6-2-1-3-7-24/h1-21H/b20-14+,21-15+ |
| InChIKey | RRHOKKMCLFQGEL-OZNQKUEASA-N |
| XLogP | 9.33 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.33 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone?
The IUPAC name of [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone (CID 166593599) is [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone.
What is the SMILES notation for [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone?
The canonical SMILES for [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone is O=C(c1ccccc1)c1c(/C=C/c2ccc(Br)cc2)nc2ccccc2c1/C=C/c1ccc(Br)cc1.
What is the InChIKey of [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone?
The InChIKey is RRHOKKMCLFQGEL-OZNQKUEASA-N. The full InChI is InChI=1S/C32H21Br2NO/c33-25-16-10-22(11-17-25)14-20-28-27-8-4-5-9-29(27)35-30(21-15-23-12-18-26(34)19-13-23)31(28)32(36)24-6-2-1-3-7-24/h1-21H/b20-14+,21-15+.
What are the key properties of [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone?
[2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone has a molecular weight of 595.33 g/mol, XLogP of 9.33, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis[(E)-2-(4-bromophenyl)ethenyl]quinolin-3-yl]-phenylmethanone is sourced from PubChem (CID 166593599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).