C28H30F2N2OS — CID 166593608
(1S,2R,13R,14S,17R,18S)-7-(2,5-difluoroanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol (PubChem CID 166593608) has the molecular formula C28H30F2N2OS and a molecular weight of 480.62 g/mol. Its IUPAC name is (1S,2R,13R,14S,17R,18S)-7-(2,5-difluoroanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17R,18S)-7-(2,5-difluoroanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
|---|---|
| PubChem CID | 166593608 |
| Molecular Formula | C28H30F2N2OS |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (1S,2R,13R,14S,17R,18S)-7-(2,5-difluoroanilino)-17-ethynyl-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-ol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CC=C4c5sc(Nc6cc(F)ccc6F)nc5CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H30F2N2OS/c1-4-28(33)14-10-19-17-6-7-20-24-22(11-12-26(20,2)18(17)9-13-27(19,28)3)31-25(34-24)32-23-15-16(29)5-8-21(23)30/h1,5,7-8,15,17-19,33H,6,9-14H2,2-3H3,(H,31,32)/t17-,18+,19+,26-,27+,28+/m1/s1 |
| InChIKey | QRBALHIQNFMOLW-RBTWKDBCSA-N |
| XLogP | 6.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|