C31H27NO5 — CID 166593623
15-(4-methoxyphenyl)-11-(3,4,5-trimethoxyphenyl)-12-oxa-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene (PubChem CID 166593623) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is 15-(4-methoxyphenyl)-11-(3,4,5-trimethoxyphenyl)-12-oxa-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene.
| Compound Name | 15-(4-methoxyphenyl)-11-(3,4,5-trimethoxyphenyl)-12-oxa-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene |
|---|---|
| PubChem CID | 166593623 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 15-(4-methoxyphenyl)-11-(3,4,5-trimethoxyphenyl)-12-oxa-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene |
| SMILES | COc1ccc(-c2cc3c4c(nc5ccccc5c4c2)CC(c2cc(OC)c(OC)c(OC)c2)O3)cc1 |
| InChI | InChI=1S/C31H27NO5/c1-33-21-11-9-18(10-12-21)19-13-23-22-7-5-6-8-24(22)32-25-17-26(37-27(14-19)30(23)25)20-15-28(34-2)31(36-4)29(16-20)35-3/h5-16,26H,17H2,1-4H3 |
| InChIKey | GYAAORMLZPKDCY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|