C13H16F2N2O3S — CID 166594144
(2-amino-4-methylsulfonylphenyl)-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 166594144) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.34 g/mol. Its IUPAC name is (2-amino-4-methylsulfonylphenyl)-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | (2-amino-4-methylsulfonylphenyl)-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 166594144 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (2-amino-4-methylsulfonylphenyl)-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCC(F)(F)CC2)c(N)c1 |
| InChI | InChI=1S/C13H16F2N2O3S/c1-21(19,20)9-2-3-10(11(16)8-9)12(18)17-6-4-13(14,15)5-7-17/h2-3,8H,4-7,16H2,1H3 |
| InChIKey | VMDUIDYKBPQAOH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|