C20H23N5O — CID 166594360
3-methyl-4-[[5-[4-(1-methylpyrazol-4-yl)phenyl]pyrazolidin-3-yl]amino]phenol (PubChem CID 166594360) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-methyl-4-[[5-[4-(1-methylpyrazol-4-yl)phenyl]pyrazolidin-3-yl]amino]phenol.
| Compound Name | 3-methyl-4-[[5-[4-(1-methylpyrazol-4-yl)phenyl]pyrazolidin-3-yl]amino]phenol |
|---|---|
| PubChem CID | 166594360 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-methyl-4-[[5-[4-(1-methylpyrazol-4-yl)phenyl]pyrazolidin-3-yl]amino]phenol |
| SMILES | Cc1cc(O)ccc1NC1CC(c2ccc(-c3cnn(C)c3)cc2)NN1 |
| InChI | InChI=1S/C20H23N5O/c1-13-9-17(26)7-8-18(13)22-20-10-19(23-24-20)15-5-3-14(4-6-15)16-11-21-25(2)12-16/h3-9,11-12,19-20,22-24,26H,10H2,1-2H3 |
| InChIKey | IJKUVGVFFXQEBZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|