C16H15BrN6O3S2 — CID 166594897
4-[3-(4-bromophenyl)-5-(2-hydrazinyl-2-oxoethyl)sulfanyl-1,2,4-triazol-4-yl]benzenesulfonamide (PubChem CID 166594897) has the molecular formula C16H15BrN6O3S2 and a molecular weight of 483.37 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)-5-(2-hydrazinyl-2-oxoethyl)sulfanyl-1,2,4-triazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-bromophenyl)-5-(2-hydrazinyl-2-oxoethyl)sulfanyl-1,2,4-triazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166594897 |
| Molecular Formula | C16H15BrN6O3S2 |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | 4-[3-(4-bromophenyl)-5-(2-hydrazinyl-2-oxoethyl)sulfanyl-1,2,4-triazol-4-yl]benzenesulfonamide |
| SMILES | NNC(=O)CSc1nnc(-c2ccc(Br)cc2)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H15BrN6O3S2/c17-11-3-1-10(2-4-11)15-21-22-16(27-9-14(24)20-18)23(15)12-5-7-13(8-6-12)28(19,25)26/h1-8H,9,18H2,(H,20,24)(H2,19,25,26) |
| InChIKey | DVDWTHBCHIOPHF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|