C17H16N3+ — CID 166595054
(5S)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium (PubChem CID 166595054) has the molecular formula C17H16N3+ and a molecular weight of 262.34 g/mol. Its IUPAC name is (5S)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium.
| Compound Name | (5S)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium |
|---|---|
| PubChem CID | 166595054 |
| Molecular Formula | C17H16N3+ |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (5S)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium |
| SMILES | c1ccc([C@@H]2CCc3nn(-c4ccccc4)c[n+]32)cc1 |
| InChI | InChI=1S/C17H16N3/c1-3-7-14(8-4-1)16-11-12-17-18-20(13-19(16)17)15-9-5-2-6-10-15/h1-10,13,16H,11-12H2/q+1/t16-/m0/s1 |
| InChIKey | LKPWYRULUIRHMC-INIZCTEOSA-N |
| XLogP | 2.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|