C17H16BF4N3 — CID 166595055
(5R)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate (PubChem CID 166595055) has the molecular formula C17H16BF4N3 and a molecular weight of 349.14 g/mol. Its IUPAC name is (5R)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate.
| Compound Name | (5R)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate |
|---|---|
| PubChem CID | 166595055 |
| Molecular Formula | C17H16BF4N3 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (5R)-2,5-diphenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc([C@H]2CCc3nn(-c4ccccc4)c[n+]32)cc1 |
| InChI | InChI=1S/C17H16N3.BF4/c1-3-7-14(8-4-1)16-11-12-17-18-20(13-19(16)17)15-9-5-2-6-10-15;2-1(3,4)5/h1-10,13,16H,11-12H2;/q+1;-1/t16-;/m1./s1 |
| InChIKey | AKNHSPVEWBRPGR-PKLMIRHRSA-N |
| XLogP | 4.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|