About 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine
3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine (PubChem CID 166595407) has the molecular formula C8H6BrFN2O
and a molecular weight of 245.05 g/mol. Its IUPAC name is 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 166595407 |
| Molecular Formula | C8H6BrFN2O |
| Molecular Weight | 245.05 g/mol |
| Exact Mass | 243.96 |
| IUPAC Name | 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cnc2[nH]cc(Br)c2c1F |
| InChI | InChI=1S/C8H6BrFN2O/c1-13-5-3-12-8-6(7(5)10)4(9)2-11-8/h2-3H,1H3,(H,11,12) |
| InChIKey | MSCGMEDTWSRBLD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.05 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine (CID 166595407) is 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine is COc1cnc2[nH]cc(Br)c2c1F.
What is the InChIKey of 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is MSCGMEDTWSRBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrFN2O/c1-13-5-3-12-8-6(7(5)10)4(9)2-11-8/h2-3H,1H3,(H,11,12).
What are the key properties of 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine?
3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 245.05 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 166595407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).