About (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate
(4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate (PubChem CID 166595625) has the molecular formula C18H18FN5O3
and a molecular weight of 371.37 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate |
| PubChem CID | 166595625 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate |
| SMILES | Cc1ncnc2nc(C3CN(C(=O)OCc4ccc(F)cc4)CCO3)[nH]c12 |
| InChI | InChI=1S/C18H18FN5O3/c1-11-15-17(21-10-20-11)23-16(22-15)14-8-24(6-7-26-14)18(25)27-9-12-2-4-13(19)5-3-12/h2-5,10,14H,6-9H2,1H3,(H,20,21,22,23) |
| InChIKey | XJXRXMWVEBLCSM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate?
The IUPAC name of (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate (CID 166595625) is (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate.
What is the SMILES notation for (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate?
The canonical SMILES for (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate is Cc1ncnc2nc(C3CN(C(=O)OCc4ccc(F)cc4)CCO3)[nH]c12.
What is the InChIKey of (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate?
The InChIKey is XJXRXMWVEBLCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN5O3/c1-11-15-17(21-10-20-11)23-16(22-15)14-8-24(6-7-26-14)18(25)27-9-12-2-4-13(19)5-3-12/h2-5,10,14H,6-9H2,1H3,(H,20,21,22,23).
What are the key properties of (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate?
(4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate has a molecular weight of 371.37 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 2-(6-methyl-7H-purin-8-yl)morpholine-4-carboxylate is sourced from PubChem (CID 166595625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).