C27H33N7O2 — CID 166595849
(1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-(methylhydrazinylidene)-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 166595849) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-(methylhydrazinylidene)-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-(methylhydrazinylidene)-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166595849 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-(methylhydrazinylidene)-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | CN/N=C1\N=CN=C2C1C=CN2[C@@H]1C[C@H](CCc2ccc3ccc(NCC4CC4)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33N7O2/c1-28-33-26-20-10-11-34(27(20)31-15-30-26)22-13-19(24(35)25(22)36)7-5-16-4-6-18-8-9-23(32-21(18)12-16)29-14-17-2-3-17/h4,6,8-12,15,17,19-20,22,24-25,28,35-36H,2-3,5,7,13-14H2,1H3,(H,29,32)/b33-26-/t19-,20?,22+,24+,25-/m0/s1 |
| InChIKey | GMJBVLQDAYIJHN-XMEPAROMSA-N |
| XLogP | 2.52 |
| TPSA | 117.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|