C26H30N6O3 — CID 166596091
(1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-hydroxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol (PubChem CID 166596091) has the molecular formula C26H30N6O3 and a molecular weight of 474.57 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-hydroxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-hydroxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166596091 |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-[2-(cyclopropylmethylamino)quinolin-7-yl]ethyl]-5-[(4Z)-4-hydroxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentane-1,2-diol |
| SMILES | O/N=C1\N=CN=C2C1C=CN2[C@@H]1C[C@H](CCc2ccc3ccc(NCC4CC4)nc3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H30N6O3/c33-23-18(12-21(24(23)34)32-10-9-19-25(31-35)28-14-29-26(19)32)6-4-15-3-5-17-7-8-22(30-20(17)11-15)27-13-16-1-2-16/h3,5,7-11,14,16,18-19,21,23-24,33-35H,1-2,4,6,12-13H2,(H,27,30)/b31-25-/t18-,19?,21+,23+,24-/m0/s1 |
| InChIKey | FGJVGMHXESOXLF-FJHSYYAOSA-N |
| XLogP | 2.77 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|