C18H23N5O — CID 166596113
2-[2-(5-pyridin-4-yl-1H-imidazol-2-yl)ethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 166596113) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-[2-(5-pyridin-4-yl-1H-imidazol-2-yl)ethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 2-[2-(5-pyridin-4-yl-1H-imidazol-2-yl)ethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 166596113 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[2-(5-pyridin-4-yl-1H-imidazol-2-yl)ethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(CCc2ncc(-c3ccncc3)[nH]2)NC2CCCCC12 |
| InChI | InChI=1S/C18H23N5O/c24-18-13-3-1-2-4-14(13)21-17(23-18)6-5-16-20-11-15(22-16)12-7-9-19-10-8-12/h7-11,13-14,17,21H,1-6H2,(H,20,22)(H,23,24) |
| InChIKey | CCLXMYNFBAGMQQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |