C24H25N10O+ — CID 166596235
12-methyl-5-[1-[(1-methylpyrazolo[4,5-b]pyridin-6-yl)methyl]pyrazol-4-yl]-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one (PubChem CID 166596235) has the molecular formula C24H25N10O+ and a molecular weight of 469.53 g/mol. Its IUPAC name is 12-methyl-5-[1-[(1-methylpyrazolo[4,5-b]pyridin-6-yl)methyl]pyrazol-4-yl]-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one.
| Compound Name | 12-methyl-5-[1-[(1-methylpyrazolo[4,5-b]pyridin-6-yl)methyl]pyrazol-4-yl]-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one |
|---|---|
| PubChem CID | 166596235 |
| Molecular Formula | C24H25N10O+ |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 12-methyl-5-[1-[(1-methylpyrazolo[4,5-b]pyridin-6-yl)methyl]pyrazol-4-yl]-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one |
| SMILES | CCCCC[n+]1c2c(c(=O)n3c(C)nnc31)=NC(c1cnn(Cc3cnc4cnn(C)c4c3)c1)=C2 |
| InChI | InChI=1S/C24H25N10O/c1-4-5-6-7-33-21-9-18(28-22(21)23(35)34-15(2)29-30-24(33)34)17-11-27-32(14-17)13-16-8-20-19(25-10-16)12-26-31(20)3/h8-12,14H,4-7,13H2,1-3H3/q+1 |
| InChIKey | JGYXGYIGXSBZAN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|