C14H18N5O+ — CID 166596293
6,12-dimethyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one (PubChem CID 166596293) has the molecular formula C14H18N5O+ and a molecular weight of 272.33 g/mol. Its IUPAC name is 6,12-dimethyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one.
| Compound Name | 6,12-dimethyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one |
|---|---|
| PubChem CID | 166596293 |
| Molecular Formula | C14H18N5O+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 6,12-dimethyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one |
| SMILES | CCCCC[n+]1c2c(c(=O)n3c(C)nnc31)=NC=C2C |
| InChI | InChI=1S/C14H18N5O/c1-4-5-6-7-18-12-9(2)8-15-11(12)13(20)19-10(3)16-17-14(18)19/h8H,4-7H2,1-3H3/q+1 |
| InChIKey | VWNAXNREERHPOC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|