C23H24N7O+ — CID 166596316
5-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one (PubChem CID 166596316) has the molecular formula C23H24N7O+ and a molecular weight of 414.49 g/mol. Its IUPAC name is 5-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one.
| Compound Name | 5-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one |
|---|---|
| PubChem CID | 166596316 |
| Molecular Formula | C23H24N7O+ |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 5-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,10,11-tetraza-8-azoniatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-2-one |
| SMILES | CCCCC[n+]1c2c(c(=O)n3c(C)nnc31)=NC(c1cnn(Cc3ccccc3)c1)=C2 |
| InChI | InChI=1S/C23H24N7O/c1-3-4-8-11-29-20-12-19(25-21(20)22(31)30-16(2)26-27-23(29)30)18-13-24-28(15-18)14-17-9-6-5-7-10-17/h5-7,9-10,12-13,15H,3-4,8,11,14H2,1-2H3/q+1 |
| InChIKey | RSKXIZZQSPDKBA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|