C23H22F2N6O3 — CID 166596381
3-[5-[(5R)-3-cyclopropyl-5,7-dimethyl-6-oxo-5,8-dihydroimidazo[1,5-a]pyrazin-1-yl]-3-(difluoromethyl)quinolin-2-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 166596381) has the molecular formula C23H22F2N6O3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 3-[5-[(5R)-3-cyclopropyl-5,7-dimethyl-6-oxo-5,8-dihydroimidazo[1,5-a]pyrazin-1-yl]-3-(difluoromethyl)quinolin-2-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[5-[(5R)-3-cyclopropyl-5,7-dimethyl-6-oxo-5,8-dihydroimidazo[1,5-a]pyrazin-1-yl]-3-(difluoromethyl)quinolin-2-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 166596381 |
| Molecular Formula | C23H22F2N6O3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[5-[(5R)-3-cyclopropyl-5,7-dimethyl-6-oxo-5,8-dihydroimidazo[1,5-a]pyrazin-1-yl]-3-(difluoromethyl)quinolin-2-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | C[C@@H]1C(=O)N(C)Cc2c(-c3cccc4nc(C5NOC(=O)N5)c(C(F)F)cc34)nc(C3CC3)n21 |
| InChI | InChI=1S/C23H22F2N6O3/c1-10-22(32)30(2)9-16-17(27-21(31(10)16)11-6-7-11)12-4-3-5-15-13(12)8-14(19(24)25)18(26-15)20-28-23(33)34-29-20/h3-5,8,10-11,19-20,29H,6-7,9H2,1-2H3,(H,28,33)/t10-,20?/m1/s1 |
| InChIKey | WGRCWRNTKOVBSI-LZGFGWTLSA-N |
| XLogP | 3.69 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |