C18H12N4OS — CID 16659645
13-(4-methylphenyl)-10-thia-3,8,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one (PubChem CID 16659645) has the molecular formula C18H12N4OS and a molecular weight of 332.39 g/mol. Its IUPAC name is 13-(4-methylphenyl)-10-thia-3,8,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one.
| Compound Name | 13-(4-methylphenyl)-10-thia-3,8,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one |
|---|---|
| PubChem CID | 16659645 |
| Molecular Formula | C18H12N4OS |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 13-(4-methylphenyl)-10-thia-3,8,13,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one |
| SMILES | Cc1ccc(-n2cnc3c(sc4ncc5cc[nH]c5c43)c2=O)cc1 |
| InChI | InChI=1S/C18H12N4OS/c1-10-2-4-12(5-3-10)22-9-21-15-13-14-11(6-7-19-14)8-20-17(13)24-16(15)18(22)23/h2-9,19H,1H3 |
| InChIKey | FGQIFROFERTXDJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |