C24H28N6O3 — CID 166596482
(1R,2S,3R,5S)-3-[(4Z)-4-methoxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol (PubChem CID 166596482) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[(4Z)-4-methoxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[(4Z)-4-methoxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166596482 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (1R,2S,3R,5S)-3-[(4Z)-4-methoxyimino-4aH-pyrrolo[2,3-d]pyrimidin-7-yl]-5-[2-[2-(methylamino)quinolin-7-yl]ethyl]cyclopentane-1,2-diol |
| SMILES | CNc1ccc2ccc(CC[C@H]3C[C@@H](N4C=CC5C4=NC=N/C5=N\OC)[C@H](O)[C@@H]3O)cc2n1 |
| InChI | InChI=1S/C24H28N6O3/c1-25-20-8-7-15-5-3-14(11-18(15)28-20)4-6-16-12-19(22(32)21(16)31)30-10-9-17-23(29-33-2)26-13-27-24(17)30/h3,5,7-11,13,16-17,19,21-22,31-32H,4,6,12H2,1-2H3,(H,25,28)/b29-23-/t16-,17?,19+,21+,22-/m0/s1 |
| InChIKey | FCVSOZCDRSGBRT-QUXHTLQESA-N |
| XLogP | 2.17 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|