C25H26N4O3 — CID 16659662
(E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(7R)-8-oxo-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-13-yl]prop-2-enamide (PubChem CID 16659662) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(7R)-8-oxo-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-13-yl]prop-2-enamide.
| Compound Name | (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(7R)-8-oxo-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-13-yl]prop-2-enamide |
|---|---|
| PubChem CID | 16659662 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (E)-N-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[(7R)-8-oxo-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-13-yl]prop-2-enamide |
| SMILES | Cc1c(CN(C)C(=O)/C=C/c2cnc3c(c2)CN2CCC[C@@H]2C(=O)N3)oc2ccccc12 |
| InChI | InChI=1S/C25H26N4O3/c1-16-19-6-3-4-8-21(19)32-22(16)15-28(2)23(30)10-9-17-12-18-14-29-11-5-7-20(29)25(31)27-24(18)26-13-17/h3-4,6,8-10,12-13,20H,5,7,11,14-15H2,1-2H3,(H,26,27,31)/b10-9+/t20-/m1/s1 |
| InChIKey | UUUZNJSKVSCNNL-SQUSKLHYSA-N |
| XLogP | 3.72 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|