About 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol
1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol (PubChem CID 166596851) has the molecular formula C11H9BrClNO2
and a molecular weight of 302.56 g/mol. Its IUPAC name is 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol |
| PubChem CID | 166596851 |
| Molecular Formula | C11H9BrClNO2 |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol |
| SMILES | CC(O)c1cc(-c2c(Cl)cccc2Br)no1 |
| InChI | InChI=1S/C11H9BrClNO2/c1-6(15)10-5-9(14-16-10)11-7(12)3-2-4-8(11)13/h2-6,15H,1H3 |
| InChIKey | CKMNQMFADZIHPG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol?
The IUPAC name of 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol (CID 166596851) is 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol.
What is the SMILES notation for 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol?
The canonical SMILES for 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol is CC(O)c1cc(-c2c(Cl)cccc2Br)no1.
What is the InChIKey of 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol?
The InChIKey is CKMNQMFADZIHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrClNO2/c1-6(15)10-5-9(14-16-10)11-7(12)3-2-4-8(11)13/h2-6,15H,1H3.
What are the key properties of 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol?
1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol has a molecular weight of 302.56 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-bromo-6-chlorophenyl)-1,2-oxazol-5-yl]ethanol is sourced from PubChem (CID 166596851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).