About 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole
5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole (PubChem CID 166596940) has the molecular formula C10H5BrCl3NO
and a molecular weight of 341.42 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole |
| PubChem CID | 166596940 |
| Molecular Formula | C10H5BrCl3NO |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 338.86 |
| IUPAC Name | 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole |
| SMILES | Clc1ccc(Cl)c(-c2cc(CBr)on2)c1Cl |
| InChI | InChI=1S/C10H5BrCl3NO/c11-4-5-3-8(15-16-5)9-6(12)1-2-7(13)10(9)14/h1-3H,4H2 |
| InChIKey | AQVJEROZFYQQRP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole?
The IUPAC name of 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole (CID 166596940) is 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole.
What is the SMILES notation for 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole?
The canonical SMILES for 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole is Clc1ccc(Cl)c(-c2cc(CBr)on2)c1Cl.
What is the InChIKey of 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole?
The InChIKey is AQVJEROZFYQQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrCl3NO/c11-4-5-3-8(15-16-5)9-6(12)1-2-7(13)10(9)14/h1-3H,4H2.
What are the key properties of 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole?
5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole has a molecular weight of 341.42 g/mol, XLogP of 5.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-3-(2,3,6-trichlorophenyl)-1,2-oxazole is sourced from PubChem (CID 166596940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).