C20H29N3O4 — CID 16659702
6-[(3R)-3-(2,2-dimethylpropyl)-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide (PubChem CID 16659702) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 6-[(3R)-3-(2,2-dimethylpropyl)-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[(3R)-3-(2,2-dimethylpropyl)-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 16659702 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 6-[(3R)-3-(2,2-dimethylpropyl)-2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl]-N-hydroxyhexanamide |
| SMILES | CC(C)(C)C[C@H]1NC(=O)c2ccccc2N(CCCCCC(=O)NO)C1=O |
| InChI | InChI=1S/C20H29N3O4/c1-20(2,3)13-15-19(26)23(12-8-4-5-11-17(24)22-27)16-10-7-6-9-14(16)18(25)21-15/h6-7,9-10,15,27H,4-5,8,11-13H2,1-3H3,(H,21,25)(H,22,24)/t15-/m1/s1 |
| InChIKey | HIXXQZWAPFTNBN-OAHLLOKOSA-N |
| XLogP | 2.63 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|