About [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine
[3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine (PubChem CID 166597486) has the molecular formula C10H8Br2N2O
and a molecular weight of 332.00 g/mol. Its IUPAC name is [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine |
| PubChem CID | 166597486 |
| Molecular Formula | C10H8Br2N2O |
| Molecular Weight | 332.00 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine |
| SMILES | NCc1cc(-c2cc(Br)ccc2Br)no1 |
| InChI | InChI=1S/C10H8Br2N2O/c11-6-1-2-9(12)8(3-6)10-4-7(5-13)15-14-10/h1-4H,5,13H2 |
| InChIKey | SVONSZKUOACDNG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.00 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine?
The IUPAC name of [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine (CID 166597486) is [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine.
What is the SMILES notation for [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine?
The canonical SMILES for [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine is NCc1cc(-c2cc(Br)ccc2Br)no1.
What is the InChIKey of [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine?
The InChIKey is SVONSZKUOACDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Br2N2O/c11-6-1-2-9(12)8(3-6)10-4-7(5-13)15-14-10/h1-4H,5,13H2.
What are the key properties of [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine?
[3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine has a molecular weight of 332.00 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,5-dibromophenyl)-1,2-oxazol-5-yl]methanamine is sourced from PubChem (CID 166597486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).