About 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione
6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione (PubChem CID 166597670) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione.
Molecular Properties
| Compound Name | 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione |
| PubChem CID | 166597670 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2cc(OCC3CCCCC3)ccc12 |
| InChI | InChI=1S/C15H18N2O3/c18-14-12-7-6-11(8-13(12)15(19)17-16-14)20-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H,16,18)(H,17,19) |
| InChIKey | PCAWJIMDNGAMRA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione?
The IUPAC name of 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione (CID 166597670) is 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione.
What is the SMILES notation for 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione?
The canonical SMILES for 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione is O=c1[nH][nH]c(=O)c2cc(OCC3CCCCC3)ccc12.
What is the InChIKey of 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione?
The InChIKey is PCAWJIMDNGAMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c18-14-12-7-6-11(8-13(12)15(19)17-16-14)20-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H,16,18)(H,17,19).
What are the key properties of 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione?
6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione has a molecular weight of 274.32 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexylmethoxy)-2,3-dihydrophthalazine-1,4-dione is sourced from PubChem (CID 166597670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).