C15H16ClN5O — CID 166597832
3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 166597832) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 166597832 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(1H-pyrrol-2-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cc1ncc2c(c1-c1noc(-c3ccc[nH]3)n1)CCNC2.Cl |
| InChI | InChI=1S/C15H15N5O.ClH/c1-9-13(11-4-6-16-7-10(11)8-18-9)14-19-15(21-20-14)12-3-2-5-17-12;/h2-3,5,8,16-17H,4,6-7H2,1H3;1H |
| InChIKey | OEXHBOIYKZZICR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |