C19H23F2NO5 — CID 166598363
(2,3-difluoro-6-methoxyphenyl)-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)methanone;formic acid (PubChem CID 166598363) has the molecular formula C19H23F2NO5 and a molecular weight of 383.39 g/mol. Its IUPAC name is (2,3-difluoro-6-methoxyphenyl)-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)methanone;formic acid.
| Compound Name | (2,3-difluoro-6-methoxyphenyl)-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)methanone;formic acid |
|---|---|
| PubChem CID | 166598363 |
| Molecular Formula | C19H23F2NO5 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (2,3-difluoro-6-methoxyphenyl)-(4-methyl-1-oxa-9-azaspiro[5.5]undec-4-en-9-yl)methanone;formic acid |
| SMILES | COc1ccc(F)c(F)c1C(=O)N1CCC2(C=C(C)CCO2)CC1.O=CO |
| InChI | InChI=1S/C18H21F2NO3.CH2O2/c1-12-5-10-24-18(11-12)6-8-21(9-7-18)17(22)15-14(23-2)4-3-13(19)16(15)20;2-1-3/h3-4,11H,5-10H2,1-2H3;1H,(H,2,3) |
| InChIKey | UJAXWGFSXQEXAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|