C17H24N6O5S — CID 166598788
N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide;formic acid (PubChem CID 166598788) has the molecular formula C17H24N6O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide;formic acid.
| Compound Name | N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 166598788 |
| Molecular Formula | C17H24N6O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide;formic acid |
| SMILES | CCn1cnnc1CCNC(=O)[C@H]1C[C@H](NC(=O)c2cscn2)[C@@H](O)C1.O=CO |
| InChI | InChI=1S/C16H22N6O3S.CH2O2/c1-2-22-8-19-21-14(22)3-4-17-15(24)10-5-11(13(23)6-10)20-16(25)12-7-26-9-18-12;2-1-3/h7-11,13,23H,2-6H2,1H3,(H,17,24)(H,20,25);1H,(H,2,3)/t10-,11-,13-;/m0./s1 |
| InChIKey | KKORLDLHNUWHJS-SQRKDXEHSA-N |
| XLogP | -0.32 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|