C21H32N2O4 — CID 166598794
3-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-N-propan-2-ylpropanamide;formic acid (PubChem CID 166598794) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-N-propan-2-ylpropanamide;formic acid.
| Compound Name | 3-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-N-propan-2-ylpropanamide;formic acid |
|---|---|
| PubChem CID | 166598794 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 3-[(1S,2S,4R)-2-benzyl-2-(hydroxymethyl)-7-azabicyclo[2.2.1]heptan-7-yl]-N-propan-2-ylpropanamide;formic acid |
| SMILES | CC(C)NC(=O)CCN1[C@@H]2CC[C@H]1[C@](CO)(Cc1ccccc1)C2.O=CO |
| InChI | InChI=1S/C20H30N2O2.CH2O2/c1-15(2)21-19(24)10-11-22-17-8-9-18(22)20(13-17,14-23)12-16-6-4-3-5-7-16;2-1-3/h3-7,15,17-18,23H,8-14H2,1-2H3,(H,21,24);1H,(H,2,3)/t17-,18+,20-;/m1./s1 |
| InChIKey | KSAYNSOGPRFVSA-FLQNVMKHSA-N |
| XLogP | 2.06 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|