C27H40FNO10S — CID 16659916
ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-hexylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 16659916) has the molecular formula C27H40FNO10S and a molecular weight of 589.68 g/mol. Its IUPAC name is ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-hexylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-hexylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 16659916 |
| Molecular Formula | C27H40FNO10S |
| Molecular Weight | 589.68 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-hexylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCCCCCc1cc(F)ccc1NS(=O)(=O)C1CCC2(C=C1C(=O)OCC)OC(C(O)CO)C(C(O)CO)O2 |
| InChI | InChI=1S/C27H40FNO10S/c1-3-5-6-7-8-17-13-18(28)9-10-20(17)29-40(35,36)23-11-12-27(14-19(23)26(34)37-4-2)38-24(21(32)15-30)25(39-27)22(33)16-31/h9-10,13-14,21-25,29-33H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | RVWIPBRDTQZMJJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|