C20H22F2N4O6 — CID 166599488
2-(2,3-difluorophenyl)-1-[(1S,5S)-9-(5-methyl-1,3,4-oxadiazole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;formic acid (PubChem CID 166599488) has the molecular formula C20H22F2N4O6 and a molecular weight of 452.41 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-[(1S,5S)-9-(5-methyl-1,3,4-oxadiazole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;formic acid.
| Compound Name | 2-(2,3-difluorophenyl)-1-[(1S,5S)-9-(5-methyl-1,3,4-oxadiazole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 166599488 |
| Molecular Formula | C20H22F2N4O6 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-[(1S,5S)-9-(5-methyl-1,3,4-oxadiazole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-7-yl]ethanone;formic acid |
| SMILES | Cc1nnc(C(=O)N2C[C@H]3COC[C@@H]2CN(C(=O)Cc2cccc(F)c2F)C3)o1.O=CO |
| InChI | InChI=1S/C19H20F2N4O4.CH2O2/c1-11-22-23-18(29-11)19(27)25-7-12-6-24(8-14(25)10-28-9-12)16(26)5-13-3-2-4-15(20)17(13)21;2-1-3/h2-4,12,14H,5-10H2,1H3;1H,(H,2,3)/t12-,14-;/m0./s1 |
| InChIKey | KOZIFWGJGKAHSX-KYSPHBLOSA-N |
| XLogP | 0.90 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|