C17H21F3N2O5 — CID 166599576
formic acid;(3S)-1-(2-methoxyethyl)-3-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2,5-dione (PubChem CID 166599576) has the molecular formula C17H21F3N2O5 and a molecular weight of 390.36 g/mol. Its IUPAC name is formic acid;(3S)-1-(2-methoxyethyl)-3-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2,5-dione.
| Compound Name | formic acid;(3S)-1-(2-methoxyethyl)-3-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 166599576 |
| Molecular Formula | C17H21F3N2O5 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | formic acid;(3S)-1-(2-methoxyethyl)-3-methyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2,5-dione |
| SMILES | COCCN1CC(=O)N(Cc2ccc(C(F)(F)F)cc2)[C@@H](C)C1=O.O=CO |
| InChI | InChI=1S/C16H19F3N2O3.CH2O2/c1-11-15(23)20(7-8-24-2)10-14(22)21(11)9-12-3-5-13(6-4-12)16(17,18)19;2-1-3/h3-6,11H,7-10H2,1-2H3;1H,(H,2,3)/t11-;/m0./s1 |
| InChIKey | YBQXRVLJFZYLMJ-MERQFXBCSA-N |
| XLogP | 1.61 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|