C16H8ClN5OS — CID 16659963
13-(4-chlorophenyl)-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11(16),14-hexaen-12-one (PubChem CID 16659963) has the molecular formula C16H8ClN5OS and a molecular weight of 353.79 g/mol. Its IUPAC name is 13-(4-chlorophenyl)-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11(16),14-hexaen-12-one.
| Compound Name | 13-(4-chlorophenyl)-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11(16),14-hexaen-12-one |
|---|---|
| PubChem CID | 16659963 |
| Molecular Formula | C16H8ClN5OS |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 13-(4-chlorophenyl)-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11(16),14-hexaen-12-one |
| SMILES | O=c1c2sc3ncc4[nH]cnc4c3c2ncn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H8ClN5OS/c17-8-1-3-9(4-2-8)22-7-21-13-11-12-10(19-6-20-12)5-18-15(11)24-14(13)16(22)23/h1-7H,(H,19,20) |
| InChIKey | LDYVCAGANDILRN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |