C17H10ClN5OS — CID 16659964
13-(4-chlorophenyl)-3-methyl-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one (PubChem CID 16659964) has the molecular formula C17H10ClN5OS and a molecular weight of 367.82 g/mol. Its IUPAC name is 13-(4-chlorophenyl)-3-methyl-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one.
| Compound Name | 13-(4-chlorophenyl)-3-methyl-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one |
|---|---|
| PubChem CID | 16659964 |
| Molecular Formula | C17H10ClN5OS |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 13-(4-chlorophenyl)-3-methyl-10-thia-3,5,8,13,15-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,4,6,8,11(16),14-hexaen-12-one |
| SMILES | Cn1cnc2cnc3sc4c(=O)n(-c5ccc(Cl)cc5)cnc4c3c21 |
| InChI | InChI=1S/C17H10ClN5OS/c1-22-7-20-11-6-19-16-12(14(11)22)13-15(25-16)17(24)23(8-21-13)10-4-2-9(18)3-5-10/h2-8H,1H3 |
| InChIKey | TUWFZAWPLYDRPS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |