C18H25F2NO4 — CID 166599645
(3aR,6aS)-5-[(2,3-difluoro-6-methoxyphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol;formic acid (PubChem CID 166599645) has the molecular formula C18H25F2NO4 and a molecular weight of 357.40 g/mol. Its IUPAC name is (3aR,6aS)-5-[(2,3-difluoro-6-methoxyphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol;formic acid.
| Compound Name | (3aR,6aS)-5-[(2,3-difluoro-6-methoxyphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol;formic acid |
|---|---|
| PubChem CID | 166599645 |
| Molecular Formula | C18H25F2NO4 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (3aR,6aS)-5-[(2,3-difluoro-6-methoxyphenyl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol;formic acid |
| SMILES | COc1ccc(F)c(F)c1CN(C)C1C[C@H]2CC(O)C[C@H]2C1.O=CO |
| InChI | InChI=1S/C17H23F2NO2.CH2O2/c1-20(12-5-10-7-13(21)8-11(10)6-12)9-14-16(22-2)4-3-15(18)17(14)19;2-1-3/h3-4,10-13,21H,5-9H2,1-2H3;1H,(H,2,3)/t10-,11+,12?,13?; |
| InChIKey | MEGPRTXRFHAUKX-IVZGQEPRSA-N |
| XLogP | 2.66 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|