C15H19N3O4 — CID 16660022
6-(2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl)-N-hydroxyhexanamide (PubChem CID 16660022) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 6-(2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl)-N-hydroxyhexanamide.
| Compound Name | 6-(2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 16660022 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 6-(2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl)-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCC1NC(=O)c2ccccc2NC1=O)NO |
| InChI | InChI=1S/C15H19N3O4/c19-13(18-22)9-3-1-2-8-12-15(21)16-11-7-5-4-6-10(11)14(20)17-12/h4-7,12,22H,1-3,8-9H2,(H,16,21)(H,17,20)(H,18,19) |
| InChIKey | QQQCXIWILKRLBK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|