C15H24N4O2 — CID 166600760
N-tert-butyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 166600760) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-tert-butyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-tert-butyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 166600760 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-tert-butyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | COc1ccnc(N2CCCC(C(=O)NC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C15H24N4O2/c1-15(2,3)18-13(20)11-6-5-9-19(10-11)14-16-8-7-12(17-14)21-4/h7-8,11H,5-6,9-10H2,1-4H3,(H,18,20) |
| InChIKey | ORBINSSDTMZABM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |