C26H38FNO10S — CID 16660241
ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-pentylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 16660241) has the molecular formula C26H38FNO10S and a molecular weight of 575.65 g/mol. Its IUPAC name is ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-pentylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-pentylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 16660241 |
| Molecular Formula | C26H38FNO10S |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-pentylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCCCCc1cc(F)ccc1NS(=O)(=O)C1CCC2(C=C1C(=O)OCC)OC(C(O)CO)C(C(O)CO)O2 |
| InChI | InChI=1S/C26H38FNO10S/c1-3-5-6-7-16-12-17(27)8-9-19(16)28-39(34,35)22-10-11-26(13-18(22)25(33)36-4-2)37-23(20(31)14-29)24(38-26)21(32)15-30/h8-9,12-13,20-24,28-32H,3-7,10-11,14-15H2,1-2H3 |
| InChIKey | SYYMVRDPGMJNAJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|