C27H40FNO8S — CID 16660242
ethyl 8-[(4-fluoro-2-octylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 16660242) has the molecular formula C27H40FNO8S and a molecular weight of 557.68 g/mol. Its IUPAC name is ethyl 8-[(4-fluoro-2-octylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 8-[(4-fluoro-2-octylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 16660242 |
| Molecular Formula | C27H40FNO8S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | ethyl 8-[(4-fluoro-2-octylphenyl)sulfamoyl]-2,3-bis(hydroxymethyl)-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCCCCCCCc1cc(F)ccc1NS(=O)(=O)C1CCC2(C=C1C(=O)OCC)OC(CO)C(CO)O2 |
| InChI | InChI=1S/C27H40FNO8S/c1-3-5-6-7-8-9-10-19-15-20(28)11-12-22(19)29-38(33,34)25-13-14-27(16-21(25)26(32)35-4-2)36-23(17-30)24(18-31)37-27/h11-12,15-16,23-25,29-31H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | VFKVTNXESGYGRJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|