C29H44FNO10S — CID 16660243
ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-octylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate (PubChem CID 16660243) has the molecular formula C29H44FNO10S and a molecular weight of 617.73 g/mol. Its IUPAC name is ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-octylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate.
| Compound Name | ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-octylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 16660243 |
| Molecular Formula | C29H44FNO10S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | ethyl 2,3-bis(1,2-dihydroxyethyl)-8-[(4-fluoro-2-octylphenyl)sulfamoyl]-1,4-dioxaspiro[4.5]dec-6-ene-7-carboxylate |
| SMILES | CCCCCCCCc1cc(F)ccc1NS(=O)(=O)C1CCC2(C=C1C(=O)OCC)OC(C(O)CO)C(C(O)CO)O2 |
| InChI | InChI=1S/C29H44FNO10S/c1-3-5-6-7-8-9-10-19-15-20(30)11-12-22(19)31-42(37,38)25-13-14-29(16-21(25)28(36)39-4-2)40-26(23(34)17-32)27(41-29)24(35)18-33/h11-12,15-16,23-27,31-35H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | BEEPZSIDVBBJQL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|