C13H21N5O — CID 166603322
1,1,3-trimethyl-3-(1-pyrazin-2-ylpiperidin-4-yl)urea (PubChem CID 166603322) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-(1-pyrazin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1,1,3-trimethyl-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 166603322 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1,1,3-trimethyl-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
| SMILES | CN(C)C(=O)N(C)C1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C13H21N5O/c1-16(2)13(19)17(3)11-4-8-18(9-5-11)12-10-14-6-7-15-12/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | XPESAZUSCTVIMO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |