About 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea
1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea (PubChem CID 166603345) has the molecular formula C14H21FN4O
and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea |
| PubChem CID | 166603345 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)C1CCN(c2ncccc2F)CC1 |
| InChI | InChI=1S/C14H21FN4O/c1-17(2)14(20)18(3)11-6-9-19(10-7-11)13-12(15)5-4-8-16-13/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | ATIIKIOHNQZZKG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea?
The IUPAC name of 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea (CID 166603345) is 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea is CN(C)C(=O)N(C)C1CCN(c2ncccc2F)CC1.
What is the InChIKey of 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea?
The InChIKey is ATIIKIOHNQZZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FN4O/c1-17(2)14(20)18(3)11-6-9-19(10-7-11)13-12(15)5-4-8-16-13/h4-5,8,11H,6-7,9-10H2,1-3H3.
What are the key properties of 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea?
1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea has a molecular weight of 280.35 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3-fluoro-2-pyridinyl)piperidin-4-yl]-1,3,3-trimethylurea is sourced from PubChem (CID 166603345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).