C22H26N6 — CID 166603801
2-[2-(4-methylpyrazol-1-yl)ethyl]-5-(5-phenylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 166603801) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[2-(4-methylpyrazol-1-yl)ethyl]-5-(5-phenylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-[2-(4-methylpyrazol-1-yl)ethyl]-5-(5-phenylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 166603801 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-[2-(4-methylpyrazol-1-yl)ethyl]-5-(5-phenylpyrazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1cnn(CCN2CC3CN(c4cnc(-c5ccccc5)cn4)CC3C2)c1 |
| InChI | InChI=1S/C22H26N6/c1-17-9-25-28(12-17)8-7-26-13-19-15-27(16-20(19)14-26)22-11-23-21(10-24-22)18-5-3-2-4-6-18/h2-6,9-12,19-20H,7-8,13-16H2,1H3 |
| InChIKey | BSXYRAXPKAADQW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |