About 2-(2-azido-1,1-difluoroethyl)thiophene
2-(2-azido-1,1-difluoroethyl)thiophene (PubChem CID 166604060) has the molecular formula C6H5F2N3S
and a molecular weight of 189.19 g/mol. Its IUPAC name is 2-(2-azido-1,1-difluoroethyl)thiophene.
Molecular Properties
| Compound Name | 2-(2-azido-1,1-difluoroethyl)thiophene |
| PubChem CID | 166604060 |
| Molecular Formula | C6H5F2N3S |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 2-(2-azido-1,1-difluoroethyl)thiophene |
| SMILES | [N-]=[N+]=NCC(F)(F)c1cccs1 |
| InChI | InChI=1S/C6H5F2N3S/c7-6(8,4-10-11-9)5-2-1-3-12-5/h1-3H,4H2 |
| InChIKey | VMGFVCPEAQSHGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-azido-1,1-difluoroethyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-azido-1,1-difluoroethyl)thiophene?
The IUPAC name of 2-(2-azido-1,1-difluoroethyl)thiophene (CID 166604060) is 2-(2-azido-1,1-difluoroethyl)thiophene.
What is the SMILES notation for 2-(2-azido-1,1-difluoroethyl)thiophene?
The canonical SMILES for 2-(2-azido-1,1-difluoroethyl)thiophene is [N-]=[N+]=NCC(F)(F)c1cccs1.
What is the InChIKey of 2-(2-azido-1,1-difluoroethyl)thiophene?
The InChIKey is VMGFVCPEAQSHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2N3S/c7-6(8,4-10-11-9)5-2-1-3-12-5/h1-3H,4H2.
What are the key properties of 2-(2-azido-1,1-difluoroethyl)thiophene?
2-(2-azido-1,1-difluoroethyl)thiophene has a molecular weight of 189.19 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-azido-1,1-difluoroethyl)thiophene is sourced from PubChem (CID 166604060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).